C9H12N6S — CID 79239132
N-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]pyridin-2-amine (PubChem CID 79239132) has the molecular formula C9H12N6S and a molecular weight of 236.30 g/mol. Its IUPAC name is N-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]pyridin-2-amine.
| Compound Name | N-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 79239132 |
| Molecular Formula | C9H12N6S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | N-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]pyridin-2-amine |
| SMILES | CNc1cccc(CSc2nnnn2C)n1 |
| InChI | InChI=1S/C9H12N6S/c1-10-8-5-3-4-7(11-8)6-16-9-12-13-14-15(9)2/h3-5H,6H2,1-2H3,(H,10,11) |
| InChIKey | JYIJUPDEEIYRBF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |