C11H16N6S — CID 79239053
6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-N-propylpyridin-2-amine (PubChem CID 79239053) has the molecular formula C11H16N6S and a molecular weight of 264.36 g/mol. Its IUPAC name is 6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-N-propylpyridin-2-amine.
| Compound Name | 6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 79239053 |
| Molecular Formula | C11H16N6S |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-N-propylpyridin-2-amine |
| SMILES | CCCNc1cccc(CSc2nnnn2C)n1 |
| InChI | InChI=1S/C11H16N6S/c1-3-7-12-10-6-4-5-9(13-10)8-18-11-14-15-16-17(11)2/h4-6H,3,7-8H2,1-2H3,(H,12,13) |
| InChIKey | VIYPSLNRXYKUCO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |