C13H13ClN2S — CID 79239984
6-[(4-chlorophenyl)sulfanylmethyl]-N-methylpyridin-2-amine (PubChem CID 79239984) has the molecular formula C13H13ClN2S and a molecular weight of 264.78 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)sulfanylmethyl]-N-methylpyridin-2-amine.
| Compound Name | 6-[(4-chlorophenyl)sulfanylmethyl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 79239984 |
| Molecular Formula | C13H13ClN2S |
| Molecular Weight | 264.78 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 6-[(4-chlorophenyl)sulfanylmethyl]-N-methylpyridin-2-amine |
| SMILES | CNc1cccc(CSc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C13H13ClN2S/c1-15-13-4-2-3-11(16-13)9-17-12-7-5-10(14)6-8-12/h2-8H,9H2,1H3,(H,15,16) |
| InChIKey | JVKWATFENIMBCP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.78 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |