C22H34N6O — CID 67719987
4-[[[4-[2-(diethylamino)ethylamino]quinazolin-2-yl]amino]methyl]cyclohexane-1-carboxamide (PubChem CID 67719987) has the molecular formula C22H34N6O and a molecular weight of 398.56 g/mol. Its IUPAC name is 4-[[[4-[2-(diethylamino)ethylamino]quinazolin-2-yl]amino]methyl]cyclohexane-1-carboxamide.
| Compound Name | 4-[[[4-[2-(diethylamino)ethylamino]quinazolin-2-yl]amino]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 67719987 |
| Molecular Formula | C22H34N6O |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | 4-[[[4-[2-(diethylamino)ethylamino]quinazolin-2-yl]amino]methyl]cyclohexane-1-carboxamide |
| SMILES | CCN(CC)CCNc1nc(NCC2CCC(C(N)=O)CC2)nc2ccccc12 |
| InChI | InChI=1S/C22H34N6O/c1-3-28(4-2)14-13-24-21-18-7-5-6-8-19(18)26-22(27-21)25-15-16-9-11-17(12-10-16)20(23)29/h5-8,16-17H,3-4,9-15H2,1-2H3,(H2,23,29)(H2,24,25,26,27) |
| InChIKey | WQPNTIIBEVIDPG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |