C22H23FN4O — CID 111135857
1-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methyl-3-(2-phenylethyl)guanidine (PubChem CID 111135857) has the molecular formula C22H23FN4O and a molecular weight of 378.45 g/mol. Its IUPAC name is 1-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methyl-3-(2-phenylethyl)guanidine.
| Compound Name | 1-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methyl-3-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 111135857 |
| Molecular Formula | C22H23FN4O |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methyl-3-(2-phenylethyl)guanidine |
| SMILES | C/N=C(\NCCc1ccccc1)NCc1ccnc(Oc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H23FN4O/c1-24-22(26-14-11-17-5-3-2-4-6-17)27-16-18-12-13-25-21(15-18)28-20-9-7-19(23)8-10-20/h2-10,12-13,15H,11,14,16H2,1H3,(H2,24,26,27) |
| InChIKey | VYJSERDNDBLMFE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|