C20H23FIN5O2 — CID 109431758
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 109431758) has the molecular formula C20H23FIN5O2 and a molecular weight of 511.34 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109431758 |
| Molecular Formula | C20H23FIN5O2 |
| Molecular Weight | 511.34 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccnc(Oc2ccc(F)cc2)c1)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C20H22FN5O2.HI/c1-13-14(2)27-19(26-13)12-25-20(22-3)24-11-15-8-9-23-18(10-15)28-17-6-4-16(21)5-7-17;/h4-10H,11-12H2,1-3H3,(H2,22,24,25);1H |
| InChIKey | AAAYICKEJDWLJE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|