C20H23FIN5OS — CID 111534715
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111534715) has the molecular formula C20H23FIN5OS and a molecular weight of 527.41 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111534715 |
| Molecular Formula | C20H23FIN5OS |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1cnc(CN/C(=N\C)NCc2ccnc(Oc3ccc(F)cc3)c2)s1.I |
| InChI | InChI=1S/C20H22FN5OS.HI/c1-3-17-12-24-19(28-17)13-26-20(22-2)25-11-14-8-9-23-18(10-14)27-16-6-4-15(21)5-7-16;/h4-10,12H,3,11,13H2,1-2H3,(H2,22,25,26);1H |
| InChIKey | IDZUUHYHQKVJSR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|