C25H26FIN6O — CID 111851387
1-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111851387) has the molecular formula C25H26FIN6O and a molecular weight of 572.43 g/mol. Its IUPAC name is 1-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111851387 |
| Molecular Formula | C25H26FIN6O |
| Molecular Weight | 572.43 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | 1-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccnc(Oc2ccc(F)cc2)c1)NCc1ccccc1Cn1cccn1.I |
| InChI | InChI=1S/C25H25FN6O.HI/c1-27-25(30-17-20-5-2-3-6-21(20)18-32-14-4-12-31-32)29-16-19-11-13-28-24(15-19)33-23-9-7-22(26)8-10-23;/h2-15H,16-18H2,1H3,(H2,27,29,30);1H |
| InChIKey | LDYPGULAYNLWHP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|