C20H24FIN6O — CID 111906616
1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111906616) has the molecular formula C20H24FIN6O and a molecular weight of 510.36 g/mol. Its IUPAC name is 1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111906616 |
| Molecular Formula | C20H24FIN6O |
| Molecular Weight | 510.36 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1cccn1)NCc1ccc(Oc2ccc(F)cc2)nc1.I |
| InChI | InChI=1S/C20H23FN6O.HI/c1-22-20(23-10-2-12-27-13-3-11-26-27)25-15-16-4-9-19(24-14-16)28-18-7-5-17(21)6-8-18;/h3-9,11,13-14H,2,10,12,15H2,1H3,(H2,22,23,25);1H |
| InChIKey | LSLFDJAVBZRPTI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|