C25H25FN6O — CID 111864594
1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine (PubChem CID 111864594) has the molecular formula C25H25FN6O and a molecular weight of 444.51 g/mol. Its IUPAC name is 1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine.
| Compound Name | 1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111864594 |
| Molecular Formula | C25H25FN6O |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1ccc(-n2cccn2)cc1)NCc1ccc(Oc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C25H25FN6O/c1-27-25(28-15-13-19-3-8-22(9-4-19)32-16-2-14-31-32)30-18-20-5-12-24(29-17-20)33-23-10-6-21(26)7-11-23/h2-12,14,16-17H,13,15,18H2,1H3,(H2,27,28,30) |
| InChIKey | IIAVGVAMXKJHAG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|