C22H29IN6O2 — CID 111863769
1-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111863769) has the molecular formula C22H29IN6O2 and a molecular weight of 536.42 g/mol. Its IUPAC name is 1-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111863769 |
| Molecular Formula | C22H29IN6O2 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 1-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(-n2cccn2)cc1)NCc1ccc(OCCOC)nc1.I |
| InChI | InChI=1S/C22H28N6O2.HI/c1-23-22(26-17-19-6-9-21(25-16-19)30-15-14-29-2)24-12-10-18-4-7-20(8-5-18)28-13-3-11-27-28;/h3-9,11,13,16H,10,12,14-15,17H2,1-2H3,(H2,23,24,26);1H |
| InChIKey | LGMJZPCDOGRBTQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|