C24H32IN5O2 — CID 111863795
1-[(3-methoxy-4-propoxyphenyl)methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111863795) has the molecular formula C24H32IN5O2 and a molecular weight of 549.46 g/mol. Its IUPAC name is 1-[(3-methoxy-4-propoxyphenyl)methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-methoxy-4-propoxyphenyl)methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111863795 |
| Molecular Formula | C24H32IN5O2 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 1-[(3-methoxy-4-propoxyphenyl)methyl]-2-methyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCCOc1ccc(CN/C(=N/C)NCCc2ccc(-n3cccn3)cc2)cc1OC.I |
| InChI | InChI=1S/C24H31N5O2.HI/c1-4-16-31-22-11-8-20(17-23(22)30-3)18-27-24(25-2)26-14-12-19-6-9-21(10-7-19)29-15-5-13-28-29;/h5-11,13,15,17H,4,12,14,16,18H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | JPWZJOCTSJDRNE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|