C22H28IN5O3 — CID 111376697
2-methyl-1-[(4-pyrazol-1-ylphenyl)methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111376697) has the molecular formula C22H28IN5O3 and a molecular weight of 537.40 g/mol. Its IUPAC name is 2-methyl-1-[(4-pyrazol-1-ylphenyl)methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-pyrazol-1-ylphenyl)methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111376697 |
| Molecular Formula | C22H28IN5O3 |
| Molecular Weight | 537.40 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 2-methyl-1-[(4-pyrazol-1-ylphenyl)methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(-n2cccn2)cc1)NCc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C22H27N5O3.HI/c1-23-22(24-14-16-6-8-18(9-7-16)27-11-5-10-26-27)25-15-17-12-19(28-2)21(30-4)20(13-17)29-3;/h5-13H,14-15H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | NOWICJPKQZYVOF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|