C22H27FN6 — CID 111850906
1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111850906) has the molecular formula C22H27FN6 and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111850906 |
| Molecular Formula | C22H27FN6 |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(N(C)C)c(F)c1)NCc1ccccc1Cn1cccn1 |
| InChI | InChI=1S/C22H27FN6/c1-24-22(25-14-17-9-10-21(28(2)3)20(23)13-17)26-15-18-7-4-5-8-19(18)16-29-12-6-11-27-29/h4-13H,14-16H2,1-3H3,(H2,24,25,26) |
| InChIKey | WICKEWSVFHYMIF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|