C17H14F3N3O — CID 91641402
N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]quinazolin-4-amine (PubChem CID 91641402) has the molecular formula C17H14F3N3O and a molecular weight of 333.31 g/mol. Its IUPAC name is N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]quinazolin-4-amine.
| Compound Name | N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 91641402 |
| Molecular Formula | C17H14F3N3O |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]quinazolin-4-amine |
| SMILES | FC(F)(F)COc1ccc(CNc2ncnc3ccccc23)cc1 |
| InChI | InChI=1S/C17H14F3N3O/c18-17(19,20)10-24-13-7-5-12(6-8-13)9-21-16-14-3-1-2-4-15(14)22-11-23-16/h1-8,11H,9-10H2,(H,21,22,23) |
| InChIKey | WLJWRUMFTQSTHR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |