About [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol
[4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol (PubChem CID 110006461) has the molecular formula C16H16F3NO2
and a molecular weight of 311.30 g/mol. Its IUPAC name is [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol |
| PubChem CID | 110006461 |
| Molecular Formula | C16H16F3NO2 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol |
| SMILES | OCc1ccc(CNc2ccc(OCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H16F3NO2/c17-16(18,19)11-22-15-7-5-14(6-8-15)20-9-12-1-3-13(10-21)4-2-12/h1-8,20-21H,9-11H2 |
| InChIKey | SPKAIQBIVMCCLV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol?
The IUPAC name of [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol (CID 110006461) is [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol.
What is the SMILES notation for [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol?
The canonical SMILES for [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol is OCc1ccc(CNc2ccc(OCC(F)(F)F)cc2)cc1.
What is the InChIKey of [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol?
The InChIKey is SPKAIQBIVMCCLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F3NO2/c17-16(18,19)11-22-15-7-5-14(6-8-15)20-9-12-1-3-13(10-21)4-2-12/h1-8,20-21H,9-11H2.
What are the key properties of [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol?
[4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol has a molecular weight of 311.30 g/mol, XLogP of 3.73, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol is sourced from PubChem (CID 110006461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).