C16H16F3NO2 — CID 110006461
[4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol (PubChem CID 110006461) has the molecular formula C16H16F3NO2 and a molecular weight of 311.30 g/mol. Its IUPAC name is [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol.
| Compound Name | [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 110006461 |
| Molecular Formula | C16H16F3NO2 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | [4-[[4-(2,2,2-trifluoroethoxy)anilino]methyl]phenyl]methanol |
| SMILES | OCc1ccc(CNc2ccc(OCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H16F3NO2/c17-16(18,19)11-22-15-7-5-14(6-8-15)20-9-12-1-3-13(10-21)4-2-12/h1-8,20-21H,9-11H2 |
| InChIKey | SPKAIQBIVMCCLV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|