C17H15F2N3O2 — CID 36832499
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]quinazolin-4-amine (PubChem CID 36832499) has the molecular formula C17H15F2N3O2 and a molecular weight of 331.32 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]quinazolin-4-amine.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 36832499 |
| Molecular Formula | C17H15F2N3O2 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]quinazolin-4-amine |
| SMILES | COc1ccc(CNc2ncnc3ccccc23)cc1OC(F)F |
| InChI | InChI=1S/C17H15F2N3O2/c1-23-14-7-6-11(8-15(14)24-17(18)19)9-20-16-12-4-2-3-5-13(12)21-10-22-16/h2-8,10,17H,9H2,1H3,(H,20,21,22) |
| InChIKey | KHNISHGXCHKTJA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |