C21H19ClN4O — CID 10362311
6-[4-(chloromethyl)phenyl]-N-[(2-methoxyphenyl)methyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 10362311) has the molecular formula C21H19ClN4O and a molecular weight of 378.86 g/mol. Its IUPAC name is 6-[4-(chloromethyl)phenyl]-N-[(2-methoxyphenyl)methyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-[4-(chloromethyl)phenyl]-N-[(2-methoxyphenyl)methyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 10362311 |
| Molecular Formula | C21H19ClN4O |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 6-[4-(chloromethyl)phenyl]-N-[(2-methoxyphenyl)methyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | COc1ccccc1CNc1nc(-c2ccc(CCl)cc2)cn2ccnc12 |
| InChI | InChI=1S/C21H19ClN4O/c1-27-19-5-3-2-4-17(19)13-24-20-21-23-10-11-26(21)14-18(25-20)16-8-6-15(12-22)7-9-16/h2-11,14H,12-13H2,1H3,(H,24,25) |
| InChIKey | CERJUTXXLLWAEQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|