C9H13Cl2N3O — CID 79633418
2,5-dichloro-N-(3-methoxy-2-methylpropyl)pyrimidin-4-amine (PubChem CID 79633418) has the molecular formula C9H13Cl2N3O and a molecular weight of 250.13 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-methoxy-2-methylpropyl)pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-(3-methoxy-2-methylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 79633418 |
| Molecular Formula | C9H13Cl2N3O |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 2,5-dichloro-N-(3-methoxy-2-methylpropyl)pyrimidin-4-amine |
| SMILES | COCC(C)CNc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C9H13Cl2N3O/c1-6(5-15-2)3-12-8-7(10)4-13-9(11)14-8/h4,6H,3,5H2,1-2H3,(H,12,13,14) |
| InChIKey | NLHRJSMQIFJJFA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |