C10H18N4O — CID 79918826
4-N-(1-methoxy-3-methylbutan-2-yl)pyrimidine-4,5-diamine (PubChem CID 79918826) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-N-(1-methoxy-3-methylbutan-2-yl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(1-methoxy-3-methylbutan-2-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 79918826 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 4-N-(1-methoxy-3-methylbutan-2-yl)pyrimidine-4,5-diamine |
| SMILES | COCC(Nc1ncncc1N)C(C)C |
| InChI | InChI=1S/C10H18N4O/c1-7(2)9(5-15-3)14-10-8(11)4-12-6-13-10/h4,6-7,9H,5,11H2,1-3H3,(H,12,13,14) |
| InChIKey | XINYERWHVQIXKX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |