C11H17N3O5S — CID 107605578
methyl 4-[(4-methoxy-6-methylpyrimidin-2-yl)sulfamoyl]butanoate (PubChem CID 107605578) has the molecular formula C11H17N3O5S and a molecular weight of 303.34 g/mol. Its IUPAC name is methyl 4-[(4-methoxy-6-methylpyrimidin-2-yl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[(4-methoxy-6-methylpyrimidin-2-yl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 107605578 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | methyl 4-[(4-methoxy-6-methylpyrimidin-2-yl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)Nc1nc(C)cc(OC)n1 |
| InChI | InChI=1S/C11H17N3O5S/c1-8-7-9(18-2)13-11(12-8)14-20(16,17)6-4-5-10(15)19-3/h7H,4-6H2,1-3H3,(H,12,13,14) |
| InChIKey | ZBAXURHFQWMRGO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |