C12H22N4O4S — CID 106089579
N-(4,6-dimethoxypyrimidin-2-yl)-4-(ethylamino)butane-1-sulfonamide (PubChem CID 106089579) has the molecular formula C12H22N4O4S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-(4,6-dimethoxypyrimidin-2-yl)-4-(ethylamino)butane-1-sulfonamide.
| Compound Name | N-(4,6-dimethoxypyrimidin-2-yl)-4-(ethylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106089579 |
| Molecular Formula | C12H22N4O4S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-(4,6-dimethoxypyrimidin-2-yl)-4-(ethylamino)butane-1-sulfonamide |
| SMILES | CCNCCCCS(=O)(=O)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C12H22N4O4S/c1-4-13-7-5-6-8-21(17,18)16-12-14-10(19-2)9-11(15-12)20-3/h9,13H,4-8H2,1-3H3,(H,14,15,16) |
| InChIKey | WNOIYFSTBHTNBT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|