C8H12ClN3O3S — CID 107652681
2-chloro-N-(4-methoxy-6-methylpyrimidin-2-yl)ethanesulfonamide (PubChem CID 107652681) has the molecular formula C8H12ClN3O3S and a molecular weight of 265.72 g/mol. Its IUPAC name is 2-chloro-N-(4-methoxy-6-methylpyrimidin-2-yl)ethanesulfonamide.
| Compound Name | 2-chloro-N-(4-methoxy-6-methylpyrimidin-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 107652681 |
| Molecular Formula | C8H12ClN3O3S |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 2-chloro-N-(4-methoxy-6-methylpyrimidin-2-yl)ethanesulfonamide |
| SMILES | COc1cc(C)nc(NS(=O)(=O)CCCl)n1 |
| InChI | InChI=1S/C8H12ClN3O3S/c1-6-5-7(15-2)11-8(10-6)12-16(13,14)4-3-9/h5H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | WHTMHKNGQJWILF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|