C10H10BrN3O2S — CID 114296143
N-[2-(bromomethyl)phenyl]-1H-imidazole-5-sulfonamide (PubChem CID 114296143) has the molecular formula C10H10BrN3O2S and a molecular weight of 316.18 g/mol. Its IUPAC name is N-[2-(bromomethyl)phenyl]-1H-imidazole-5-sulfonamide.
| Compound Name | N-[2-(bromomethyl)phenyl]-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 114296143 |
| Molecular Formula | C10H10BrN3O2S |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | N-[2-(bromomethyl)phenyl]-1H-imidazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1CBr)c1cnc[nH]1 |
| InChI | InChI=1S/C10H10BrN3O2S/c11-5-8-3-1-2-4-9(8)14-17(15,16)10-6-12-7-13-10/h1-4,6-7,14H,5H2,(H,12,13) |
| InChIKey | YUYWUZFQJIMSOS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|