C21H17F2N2O5S- — CID 2374438
2-[(3,4-difluorophenyl)sulfonylamino]-N-(2,4-dimethoxyphenyl)benzenecarboximidate (PubChem CID 2374438) has the molecular formula C21H17F2N2O5S- and a molecular weight of 447.44 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)sulfonylamino]-N-(2,4-dimethoxyphenyl)benzenecarboximidate.
| Compound Name | 2-[(3,4-difluorophenyl)sulfonylamino]-N-(2,4-dimethoxyphenyl)benzenecarboximidate |
|---|---|
| PubChem CID | 2374438 |
| Molecular Formula | C21H17F2N2O5S- |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 2-[(3,4-difluorophenyl)sulfonylamino]-N-(2,4-dimethoxyphenyl)benzenecarboximidate |
| SMILES | COc1ccc(/N=C(/[O-])c2ccccc2NS(=O)(=O)c2ccc(F)c(F)c2)c(OC)c1 |
| InChI | InChI=1S/C21H18F2N2O5S/c1-29-13-7-10-19(20(11-13)30-2)24-21(26)15-5-3-4-6-18(15)25-31(27,28)14-8-9-16(22)17(23)12-14/h3-12,25H,1-2H3,(H,24,26)/p-1 |
| InChIKey | GBUVUSXFOVOWBT-UHFFFAOYSA-M |
| XLogP | 3.22 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|