C21H18FN3O7S — CID 71346608
N-(2,4-dimethoxyphenyl)-2-[(4-fluoro-3-nitrophenyl)sulfonylamino]benzamide (PubChem CID 71346608) has the molecular formula C21H18FN3O7S and a molecular weight of 475.45 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[(4-fluoro-3-nitrophenyl)sulfonylamino]benzamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[(4-fluoro-3-nitrophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 71346608 |
| Molecular Formula | C21H18FN3O7S |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[(4-fluoro-3-nitrophenyl)sulfonylamino]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2NS(=O)(=O)c2ccc(F)c([N+](=O)[O-])c2)c(OC)c1 |
| InChI | InChI=1S/C21H18FN3O7S/c1-31-13-7-10-18(20(11-13)32-2)23-21(26)15-5-3-4-6-17(15)24-33(29,30)14-8-9-16(22)19(12-14)25(27)28/h3-12,24H,1-2H3,(H,23,26) |
| InChIKey | VOLUKWPTLMRKTC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|