C26H21F2N3O4S — CID 3564275
N-(4-aminophenyl)-2-[(3,4-difluorophenyl)sulfonylamino]-N-(4-methoxyphenyl)benzamide (PubChem CID 3564275) has the molecular formula C26H21F2N3O4S and a molecular weight of 509.53 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-[(3,4-difluorophenyl)sulfonylamino]-N-(4-methoxyphenyl)benzamide.
| Compound Name | N-(4-aminophenyl)-2-[(3,4-difluorophenyl)sulfonylamino]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 3564275 |
| Molecular Formula | C26H21F2N3O4S |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | N-(4-aminophenyl)-2-[(3,4-difluorophenyl)sulfonylamino]-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(N(C(=O)c2ccccc2NS(=O)(=O)c2ccc(F)c(F)c2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C26H21F2N3O4S/c1-35-20-12-10-19(11-13-20)31(18-8-6-17(29)7-9-18)26(32)22-4-2-3-5-25(22)30-36(33,34)21-14-15-23(27)24(28)16-21/h2-16,30H,29H2,1H3 |
| InChIKey | UVJNWDWODDGCBX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|