C23H24N2O5S — CID 25497844
N-[(2-methoxyphenyl)methyl]-2-[(4-methoxyphenyl)sulfonylamino]-N-methylbenzamide (PubChem CID 25497844) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-2-[(4-methoxyphenyl)sulfonylamino]-N-methylbenzamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-2-[(4-methoxyphenyl)sulfonylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 25497844 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-2-[(4-methoxyphenyl)sulfonylamino]-N-methylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2C(=O)N(C)Cc2ccccc2OC)cc1 |
| InChI | InChI=1S/C23H24N2O5S/c1-25(16-17-8-4-7-11-22(17)30-3)23(26)20-9-5-6-10-21(20)24-31(27,28)19-14-12-18(29-2)13-15-19/h4-15,24H,16H2,1-3H3 |
| InChIKey | GKAHRYZBWCSQNV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |