C23H24N2O4S2 — CID 26619424
4-[(2-methoxyphenyl)sulfamoyl]-N-methyl-N-[(4-methylsulfanylphenyl)methyl]benzamide (PubChem CID 26619424) has the molecular formula C23H24N2O4S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 4-[(2-methoxyphenyl)sulfamoyl]-N-methyl-N-[(4-methylsulfanylphenyl)methyl]benzamide.
| Compound Name | 4-[(2-methoxyphenyl)sulfamoyl]-N-methyl-N-[(4-methylsulfanylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 26619424 |
| Molecular Formula | C23H24N2O4S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 4-[(2-methoxyphenyl)sulfamoyl]-N-methyl-N-[(4-methylsulfanylphenyl)methyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(C(=O)N(C)Cc2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O4S2/c1-25(16-17-8-12-19(30-3)13-9-17)23(26)18-10-14-20(15-11-18)31(27,28)24-21-6-4-5-7-22(21)29-2/h4-15,24H,16H2,1-3H3 |
| InChIKey | RLNJMYSEELRICA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |