C23H23N3O5S — CID 55637435
N-(2-anilino-2-oxoethyl)-4-[(2-methoxyphenyl)sulfamoyl]-N-methylbenzamide (PubChem CID 55637435) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is N-(2-anilino-2-oxoethyl)-4-[(2-methoxyphenyl)sulfamoyl]-N-methylbenzamide.
| Compound Name | N-(2-anilino-2-oxoethyl)-4-[(2-methoxyphenyl)sulfamoyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 55637435 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-(2-anilino-2-oxoethyl)-4-[(2-methoxyphenyl)sulfamoyl]-N-methylbenzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(C(=O)N(C)CC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H23N3O5S/c1-26(16-22(27)24-18-8-4-3-5-9-18)23(28)17-12-14-19(15-13-17)32(29,30)25-20-10-6-7-11-21(20)31-2/h3-15,25H,16H2,1-2H3,(H,24,27) |
| InChIKey | CYPBTPIFPXCSLR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |