C18H21NO3S2 — CID 26619242
N-methyl-N-[(4-methylsulfanylphenyl)methyl]-4-(methylsulfonylmethyl)benzamide (PubChem CID 26619242) has the molecular formula C18H21NO3S2 and a molecular weight of 363.50 g/mol. Its IUPAC name is N-methyl-N-[(4-methylsulfanylphenyl)methyl]-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-methyl-N-[(4-methylsulfanylphenyl)methyl]-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 26619242 |
| Molecular Formula | C18H21NO3S2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-methyl-N-[(4-methylsulfanylphenyl)methyl]-4-(methylsulfonylmethyl)benzamide |
| SMILES | CSc1ccc(CN(C)C(=O)c2ccc(CS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H21NO3S2/c1-19(12-14-6-10-17(23-2)11-7-14)18(20)16-8-4-15(5-9-16)13-24(3,21)22/h4-11H,12-13H2,1-3H3 |
| InChIKey | IOCNNCBUXDUMMH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |