C21H25FN2O3S2 — CID 26619396
4-fluoro-N-methyl-N-[(4-methylsulfanylphenyl)methyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 26619396) has the molecular formula C21H25FN2O3S2 and a molecular weight of 436.57 g/mol. Its IUPAC name is 4-fluoro-N-methyl-N-[(4-methylsulfanylphenyl)methyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-fluoro-N-methyl-N-[(4-methylsulfanylphenyl)methyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26619396 |
| Molecular Formula | C21H25FN2O3S2 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 4-fluoro-N-methyl-N-[(4-methylsulfanylphenyl)methyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CSc1ccc(CN(C)C(=O)c2ccc(F)c(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C21H25FN2O3S2/c1-23(15-16-6-9-18(28-2)10-7-16)21(25)17-8-11-19(22)20(14-17)29(26,27)24-12-4-3-5-13-24/h6-11,14H,3-5,12-13,15H2,1-2H3 |
| InChIKey | MWRCVIGNDYGSQF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |