C19H29FN3O3S+ — CID 2380936
4-fluoro-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 2380936) has the molecular formula C19H29FN3O3S+ and a molecular weight of 398.52 g/mol. Its IUPAC name is 4-fluoro-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-fluoro-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2380936 |
| Molecular Formula | C19H29FN3O3S+ |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-fluoro-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CN(C(=O)c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1)C1CC[NH+](C)CC1 |
| InChI | InChI=1S/C19H28FN3O3S/c1-21-12-8-16(9-13-21)22(2)19(24)15-6-7-17(20)18(14-15)27(25,26)23-10-4-3-5-11-23/h6-7,14,16H,3-5,8-13H2,1-2H3/p+1 |
| InChIKey | KQVHZBHGHPPCSF-UHFFFAOYSA-O |
| XLogP | 0.75 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |