C23H25FN4O3S — CID 17497833
4-fluoro-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 17497833) has the molecular formula C23H25FN4O3S and a molecular weight of 456.54 g/mol. Its IUPAC name is 4-fluoro-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-fluoro-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 17497833 |
| Molecular Formula | C23H25FN4O3S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 4-fluoro-N-methyl-N-[(1-phenylpyrazol-4-yl)methyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CN(Cc1cnn(-c2ccccc2)c1)C(=O)c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C23H25FN4O3S/c1-26(16-18-15-25-28(17-18)20-8-4-2-5-9-20)23(29)19-10-11-21(24)22(14-19)32(30,31)27-12-6-3-7-13-27/h2,4-5,8-11,14-15,17H,3,6-7,12-13,16H2,1H3 |
| InChIKey | TYPVEQZTPYLNRJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |