C23H16BrN2O3S- — CID 2332015
2-[(4-bromophenyl)sulfonylamino]-N-naphthalen-2-ylbenzenecarboximidate (PubChem CID 2332015) has the molecular formula C23H16BrN2O3S- and a molecular weight of 480.36 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonylamino]-N-naphthalen-2-ylbenzenecarboximidate.
| Compound Name | 2-[(4-bromophenyl)sulfonylamino]-N-naphthalen-2-ylbenzenecarboximidate |
|---|---|
| PubChem CID | 2332015 |
| Molecular Formula | C23H16BrN2O3S- |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonylamino]-N-naphthalen-2-ylbenzenecarboximidate |
| SMILES | O=S(=O)(Nc1ccccc1/C([O-])=N/c1ccc2ccccc2c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H17BrN2O3S/c24-18-10-13-20(14-11-18)30(28,29)26-22-8-4-3-7-21(22)23(27)25-19-12-9-16-5-1-2-6-17(16)15-19/h1-15,26H,(H,25,27)/p-1 |
| InChIKey | JOHKMXMAQVYSSP-UHFFFAOYSA-M |
| XLogP | 4.84 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|