C21H20N2O3S — CID 1095030
N-[2-(pyrrolidine-1-carbonyl)phenyl]naphthalene-2-sulfonamide (PubChem CID 1095030) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[2-(pyrrolidine-1-carbonyl)phenyl]naphthalene-2-sulfonamide.
| Compound Name | N-[2-(pyrrolidine-1-carbonyl)phenyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 1095030 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[2-(pyrrolidine-1-carbonyl)phenyl]naphthalene-2-sulfonamide |
| SMILES | O=C(c1ccccc1NS(=O)(=O)c1ccc2ccccc2c1)N1CCCC1 |
| InChI | InChI=1S/C21H20N2O3S/c24-21(23-13-5-6-14-23)19-9-3-4-10-20(19)22-27(25,26)18-12-11-16-7-1-2-8-17(16)15-18/h1-4,7-12,15,22H,5-6,13-14H2 |
| InChIKey | UJAARAMTWUIWMX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |