C18H21N3O5S — CID 166192888
1-ethyl-4-[[2-(pyrrolidine-1-carbonyl)phenyl]sulfamoyl]pyrrole-2-carboxylic acid (PubChem CID 166192888) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 1-ethyl-4-[[2-(pyrrolidine-1-carbonyl)phenyl]sulfamoyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-ethyl-4-[[2-(pyrrolidine-1-carbonyl)phenyl]sulfamoyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 166192888 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 1-ethyl-4-[[2-(pyrrolidine-1-carbonyl)phenyl]sulfamoyl]pyrrole-2-carboxylic acid |
| SMILES | CCn1cc(S(=O)(=O)Nc2ccccc2C(=O)N2CCCC2)cc1C(=O)O |
| InChI | InChI=1S/C18H21N3O5S/c1-2-20-12-13(11-16(20)18(23)24)27(25,26)19-15-8-4-3-7-14(15)17(22)21-9-5-6-10-21/h3-4,7-8,11-12,19H,2,5-6,9-10H2,1H3,(H,23,24) |
| InChIKey | NPZUXHWEAAIJPQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |