C21H15ClN2O5S2 — CID 25040897
1,3-benzothiazol-2-ylmethyl 5-[(4-chlorophenyl)sulfamoyl]-2-hydroxybenzoate (PubChem CID 25040897) has the molecular formula C21H15ClN2O5S2 and a molecular weight of 474.95 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 5-[(4-chlorophenyl)sulfamoyl]-2-hydroxybenzoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 5-[(4-chlorophenyl)sulfamoyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 25040897 |
| Molecular Formula | C21H15ClN2O5S2 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 5-[(4-chlorophenyl)sulfamoyl]-2-hydroxybenzoate |
| SMILES | O=C(OCc1nc2ccccc2s1)c1cc(S(=O)(=O)Nc2ccc(Cl)cc2)ccc1O |
| InChI | InChI=1S/C21H15ClN2O5S2/c22-13-5-7-14(8-6-13)24-31(27,28)15-9-10-18(25)16(11-15)21(26)29-12-20-23-17-3-1-2-4-19(17)30-20/h1-11,24-25H,12H2 |
| InChIKey | HPKHUIHTADUWAF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |