C12H13N3O3S2 — CID 14578280
1-(2-methylphenyl)sulfonyl-3-(4-methyl-1,3-thiazol-2-yl)urea (PubChem CID 14578280) has the molecular formula C12H13N3O3S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-(2-methylphenyl)sulfonyl-3-(4-methyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(2-methylphenyl)sulfonyl-3-(4-methyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 14578280 |
| Molecular Formula | C12H13N3O3S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 1-(2-methylphenyl)sulfonyl-3-(4-methyl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1csc(NC(=O)NS(=O)(=O)c2ccccc2C)n1 |
| InChI | InChI=1S/C12H13N3O3S2/c1-8-5-3-4-6-10(8)20(17,18)15-11(16)14-12-13-9(2)7-19-12/h3-7H,1-2H3,(H2,13,14,15,16) |
| InChIKey | LNEGLGVCMPDBKK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |