C16H16N2OS — CID 11129817
4-(6-methoxy-1,3-benzothiazol-2-yl)-N,N-dimethylaniline (PubChem CID 11129817) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is 4-(6-methoxy-1,3-benzothiazol-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(6-methoxy-1,3-benzothiazol-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 11129817 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 4-(6-methoxy-1,3-benzothiazol-2-yl)-N,N-dimethylaniline |
| SMILES | COc1ccc2nc(-c3ccc(N(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C16H16N2OS/c1-18(2)12-6-4-11(5-7-12)16-17-14-9-8-13(19-3)10-15(14)20-16/h4-10H,1-3H3 |
| InChIKey | POFIKJKJPDPHTI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|