C11H11NS2 — CID 170478464
4-(1,3-benzothiazol-6-yl)but-3-ene-1-thiol (PubChem CID 170478464) has the molecular formula C11H11NS2 and a molecular weight of 221.35 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-6-yl)but-3-ene-1-thiol.
| Compound Name | 4-(1,3-benzothiazol-6-yl)but-3-ene-1-thiol |
|---|---|
| PubChem CID | 170478464 |
| Molecular Formula | C11H11NS2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 4-(1,3-benzothiazol-6-yl)but-3-ene-1-thiol |
| SMILES | SCCC=Cc1ccc2ncsc2c1 |
| InChI | InChI=1S/C11H11NS2/c13-6-2-1-3-9-4-5-10-11(7-9)14-8-12-10/h1,3-5,7-8,13H,2,6H2 |
| InChIKey | XNMRMZPSBZOPEA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|