About 6-(4-chlorobut-1-enyl)-1,3-benzothiazole
6-(4-chlorobut-1-enyl)-1,3-benzothiazole (PubChem CID 170499284) has the molecular formula C11H10ClNS
and a molecular weight of 223.73 g/mol. Its IUPAC name is 6-(4-chlorobut-1-enyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-(4-chlorobut-1-enyl)-1,3-benzothiazole |
| PubChem CID | 170499284 |
| Molecular Formula | C11H10ClNS |
| Molecular Weight | 223.73 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 6-(4-chlorobut-1-enyl)-1,3-benzothiazole |
| SMILES | ClCCC=Cc1ccc2ncsc2c1 |
| InChI | InChI=1S/C11H10ClNS/c12-6-2-1-3-9-4-5-10-11(7-9)14-8-13-10/h1,3-5,7-8H,2,6H2 |
| InChIKey | VCWKHNHQGXTGLD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.73 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-chlorobut-1-enyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorobut-1-enyl)-1,3-benzothiazole?
The IUPAC name of 6-(4-chlorobut-1-enyl)-1,3-benzothiazole (CID 170499284) is 6-(4-chlorobut-1-enyl)-1,3-benzothiazole.
What is the SMILES notation for 6-(4-chlorobut-1-enyl)-1,3-benzothiazole?
The canonical SMILES for 6-(4-chlorobut-1-enyl)-1,3-benzothiazole is ClCCC=Cc1ccc2ncsc2c1.
What is the InChIKey of 6-(4-chlorobut-1-enyl)-1,3-benzothiazole?
The InChIKey is VCWKHNHQGXTGLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNS/c12-6-2-1-3-9-4-5-10-11(7-9)14-8-13-10/h1,3-5,7-8H,2,6H2.
What are the key properties of 6-(4-chlorobut-1-enyl)-1,3-benzothiazole?
6-(4-chlorobut-1-enyl)-1,3-benzothiazole has a molecular weight of 223.73 g/mol, XLogP of 3.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorobut-1-enyl)-1,3-benzothiazole is sourced from PubChem (CID 170499284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).