About 3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine
3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine (PubChem CID 169473733) has the molecular formula C11H12N2S
and a molecular weight of 204.30 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine.
Molecular Properties
| Compound Name | 3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine |
| PubChem CID | 169473733 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine |
| SMILES | CNCC=Cc1ccc2ncsc2c1 |
| InChI | InChI=1S/C11H12N2S/c1-12-6-2-3-9-4-5-10-11(7-9)14-8-13-10/h2-5,7-8,12H,6H2,1H3 |
| InChIKey | NWRDLCLABGUHPT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine?
The IUPAC name of 3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine (CID 169473733) is 3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine.
What is the SMILES notation for 3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine?
The canonical SMILES for 3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine is CNCC=Cc1ccc2ncsc2c1.
What is the InChIKey of 3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine?
The InChIKey is NWRDLCLABGUHPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2S/c1-12-6-2-3-9-4-5-10-11(7-9)14-8-13-10/h2-5,7-8,12H,6H2,1H3.
What are the key properties of 3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine?
3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine has a molecular weight of 204.30 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzothiazol-6-yl)-N-methylprop-2-en-1-amine is sourced from PubChem (CID 169473733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).