C22H16N2O2S2 — CID 73331494
(1E,6E)-1,7-bis(1,3-benzothiazol-6-yl)-4-methylhepta-1,6-diene-3,5-dione (PubChem CID 73331494) has the molecular formula C22H16N2O2S2 and a molecular weight of 404.52 g/mol. Its IUPAC name is (1E,6E)-1,7-bis(1,3-benzothiazol-6-yl)-4-methylhepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis(1,3-benzothiazol-6-yl)-4-methylhepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 73331494 |
| Molecular Formula | C22H16N2O2S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | (1E,6E)-1,7-bis(1,3-benzothiazol-6-yl)-4-methylhepta-1,6-diene-3,5-dione |
| SMILES | CC(C(=O)/C=C/c1ccc2ncsc2c1)C(=O)/C=C/c1ccc2ncsc2c1 |
| InChI | InChI=1S/C22H16N2O2S2/c1-14(19(25)8-4-15-2-6-17-21(10-15)27-12-23-17)20(26)9-5-16-3-7-18-22(11-16)28-13-24-18/h2-14H,1H3/b8-4+,9-5+ |
| InChIKey | XVXOZWHRLPZSKF-KBXRYBNXSA-N |
| XLogP | 5.41 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|