C18H16N2O2S — CID 169471752
benzyl N-[3-(1,3-benzothiazol-5-yl)prop-2-enyl]carbamate (PubChem CID 169471752) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is benzyl N-[3-(1,3-benzothiazol-5-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(1,3-benzothiazol-5-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169471752 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | benzyl N-[3-(1,3-benzothiazol-5-yl)prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1ccc2scnc2c1)OCc1ccccc1 |
| InChI | InChI=1S/C18H16N2O2S/c21-18(22-12-15-5-2-1-3-6-15)19-10-4-7-14-8-9-17-16(11-14)20-13-23-17/h1-9,11,13H,10,12H2,(H,19,21) |
| InChIKey | MBDBHEXSYSXTIX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |