C8H12N4O — CID 130605359
1,1-dimethyl-3-(2-methylpyrimidin-5-yl)urea (PubChem CID 130605359) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 1,1-dimethyl-3-(2-methylpyrimidin-5-yl)urea.
| Compound Name | 1,1-dimethyl-3-(2-methylpyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 130605359 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 1,1-dimethyl-3-(2-methylpyrimidin-5-yl)urea |
| SMILES | Cc1ncc(NC(=O)N(C)C)cn1 |
| InChI | InChI=1S/C8H12N4O/c1-6-9-4-7(5-10-6)11-8(13)12(2)3/h4-5H,1-3H3,(H,11,13) |
| InChIKey | KPWGSSAWXYMDSD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |