C11H13N3O2 — CID 112521669
2,4-dimethyl-N-(5-methyl-1H-pyrazol-4-yl)furan-3-carboxamide (PubChem CID 112521669) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2,4-dimethyl-N-(5-methyl-1H-pyrazol-4-yl)furan-3-carboxamide.
| Compound Name | 2,4-dimethyl-N-(5-methyl-1H-pyrazol-4-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 112521669 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2,4-dimethyl-N-(5-methyl-1H-pyrazol-4-yl)furan-3-carboxamide |
| SMILES | Cc1coc(C)c1C(=O)Nc1cn[nH]c1C |
| InChI | InChI=1S/C11H13N3O2/c1-6-5-16-8(3)10(6)11(15)13-9-4-12-14-7(9)2/h4-5H,1-3H3,(H,12,14)(H,13,15) |
| InChIKey | XOWXMRNYSWFIND-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |