C15H14N2O2 — CID 112526566
N-(1H-indol-7-yl)-2,4-dimethylfuran-3-carboxamide (PubChem CID 112526566) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is N-(1H-indol-7-yl)-2,4-dimethylfuran-3-carboxamide.
| Compound Name | N-(1H-indol-7-yl)-2,4-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 112526566 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | N-(1H-indol-7-yl)-2,4-dimethylfuran-3-carboxamide |
| SMILES | Cc1coc(C)c1C(=O)Nc1cccc2cc[nH]c12 |
| InChI | InChI=1S/C15H14N2O2/c1-9-8-19-10(2)13(9)15(18)17-12-5-3-4-11-6-7-16-14(11)12/h3-8,16H,1-2H3,(H,17,18) |
| InChIKey | NVYJNAXFCHZCML-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |