C13H13NO3 — CID 13019986
N-(3-hydroxyphenyl)-2,4-dimethylfuran-3-carboxamide (PubChem CID 13019986) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-2,4-dimethylfuran-3-carboxamide.
| Compound Name | N-(3-hydroxyphenyl)-2,4-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 13019986 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-(3-hydroxyphenyl)-2,4-dimethylfuran-3-carboxamide |
| SMILES | Cc1coc(C)c1C(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C13H13NO3/c1-8-7-17-9(2)12(8)13(16)14-10-4-3-5-11(15)6-10/h3-7,15H,1-2H3,(H,14,16) |
| InChIKey | YYCUSFTUZQDNBB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |