C10H10N4O2 — CID 47293208
N-(3-hydroxy-2-pyridinyl)-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 47293208) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is N-(3-hydroxy-2-pyridinyl)-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(3-hydroxy-2-pyridinyl)-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 47293208 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | N-(3-hydroxy-2-pyridinyl)-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ncccc2O)n[nH]1 |
| InChI | InChI=1S/C10H10N4O2/c1-6-5-7(14-13-6)10(16)12-9-8(15)3-2-4-11-9/h2-5,15H,1H3,(H,13,14)(H,11,12,16) |
| InChIKey | CTOYVYHDPMZYAL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |